About 1-methyl-5,6-dihydro-4H-pyrimidin-2-olate
1-methyl-5,6-dihydro-4H-pyrimidin-2-olate (PubChem CID 88533494) has the molecular formula C5H9N2O-
and a molecular weight of 113.14 g/mol. Its IUPAC name is 1-methyl-5,6-dihydro-4H-pyrimidin-2-olate.
Molecular Properties
| Compound Name | 1-methyl-5,6-dihydro-4H-pyrimidin-2-olate |
| PubChem CID | 88533494 |
| Molecular Formula | C5H9N2O- |
| Molecular Weight | 113.14 g/mol |
| Exact Mass | 113.07 |
| IUPAC Name | 1-methyl-5,6-dihydro-4H-pyrimidin-2-olate |
| SMILES | CN1CCCN=C1[O-] |
| InChI | InChI=1S/C5H10N2O/c1-7-4-2-3-6-5(7)8/h2-4H2,1H3,(H,6,8)/p-1 |
| InChIKey | COYPZADTXISTSJ-UHFFFAOYSA-M |
| XLogP | -0.96 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.14 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methyl-5,6-dihydro-4H-pyrimidin-2-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-5,6-dihydro-4H-pyrimidin-2-olate?
The IUPAC name of 1-methyl-5,6-dihydro-4H-pyrimidin-2-olate (CID 88533494) is 1-methyl-5,6-dihydro-4H-pyrimidin-2-olate.
What is the SMILES notation for 1-methyl-5,6-dihydro-4H-pyrimidin-2-olate?
The canonical SMILES for 1-methyl-5,6-dihydro-4H-pyrimidin-2-olate is CN1CCCN=C1[O-].
What is the InChIKey of 1-methyl-5,6-dihydro-4H-pyrimidin-2-olate?
The InChIKey is COYPZADTXISTSJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H10N2O/c1-7-4-2-3-6-5(7)8/h2-4H2,1H3,(H,6,8)/p-1.
What are the key properties of 1-methyl-5,6-dihydro-4H-pyrimidin-2-olate?
1-methyl-5,6-dihydro-4H-pyrimidin-2-olate has a molecular weight of 113.14 g/mol, XLogP of -0.96, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-5,6-dihydro-4H-pyrimidin-2-olate is sourced from PubChem (CID 88533494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).