C58H41N3 — CID 88534195
N-(4-isocyanophenyl)-9,9-dimethyl-7-phenyl-N-[4-[4-(9-phenylcarbazol-3-yl)phenyl]phenyl]fluoren-2-amine (PubChem CID 88534195) has the molecular formula C58H41N3 and a molecular weight of 779.99 g/mol. Its IUPAC name is N-(4-isocyanophenyl)-9,9-dimethyl-7-phenyl-N-[4-[4-(9-phenylcarbazol-3-yl)phenyl]phenyl]fluoren-2-amine.
| Compound Name | N-(4-isocyanophenyl)-9,9-dimethyl-7-phenyl-N-[4-[4-(9-phenylcarbazol-3-yl)phenyl]phenyl]fluoren-2-amine |
|---|---|
| PubChem CID | 88534195 |
| Molecular Formula | C58H41N3 |
| Molecular Weight | 779.99 g/mol |
| Exact Mass | 779.33 |
| IUPAC Name | N-(4-isocyanophenyl)-9,9-dimethyl-7-phenyl-N-[4-[4-(9-phenylcarbazol-3-yl)phenyl]phenyl]fluoren-2-amine |
| SMILES | [C-]#[N+]c1ccc(N(c2ccc(-c3ccc(-c4ccc5c(c4)c4ccccc4n5-c4ccccc4)cc3)cc2)c2ccc3c(c2)C(C)(C)c2cc(-c4ccccc4)ccc2-3)cc1 |
| InChI | InChI=1S/C58H41N3/c1-58(2)54-37-44(39-12-6-4-7-13-39)24-33-50(54)51-34-32-49(38-55(51)58)60(48-30-26-45(59-3)27-31-48)47-28-22-41(23-29-47)40-18-20-42(21-19-40)43-25-35-57-53(36-43)52-16-10-11-17-56(52)61(57)46-14-8-5-9-15-46/h4-38H,1-2H3 |
| InChIKey | ODCYGIGAUHEGFR-UHFFFAOYSA-N |
| XLogP | 16.11 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.99 |
| LogP ≤ 5 | 16.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|