C56H36N2O — CID 88534208
N-[4-(4-dibenzofuran-3-ylphenyl)phenyl]-N-(4-isocyanophenyl)-9,9-diphenylfluoren-2-amine (PubChem CID 88534208) has the molecular formula C56H36N2O and a molecular weight of 752.92 g/mol. Its IUPAC name is N-[4-(4-dibenzofuran-3-ylphenyl)phenyl]-N-(4-isocyanophenyl)-9,9-diphenylfluoren-2-amine.
| Compound Name | N-[4-(4-dibenzofuran-3-ylphenyl)phenyl]-N-(4-isocyanophenyl)-9,9-diphenylfluoren-2-amine |
|---|---|
| PubChem CID | 88534208 |
| Molecular Formula | C56H36N2O |
| Molecular Weight | 752.92 g/mol |
| Exact Mass | 752.28 |
| IUPAC Name | N-[4-(4-dibenzofuran-3-ylphenyl)phenyl]-N-(4-isocyanophenyl)-9,9-diphenylfluoren-2-amine |
| SMILES | [C-]#[N+]c1ccc(N(c2ccc(-c3ccc(-c4ccc5c(c4)oc4ccccc45)cc3)cc2)c2ccc3c(c2)C(c2ccccc2)(c2ccccc2)c2ccccc2-3)cc1 |
| InChI | InChI=1S/C56H36N2O/c1-57-44-27-31-46(32-28-44)58(45-29-24-39(25-30-45)38-20-22-40(23-21-38)41-26-34-51-50-17-9-11-19-54(50)59-55(51)36-41)47-33-35-49-48-16-8-10-18-52(48)56(53(49)37-47,42-12-4-2-5-13-42)43-14-6-3-7-15-43/h2-37H |
| InChIKey | WRMPNMGHMNUUFK-UHFFFAOYSA-N |
| XLogP | 15.30 |
| TPSA | 20.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.92 |
| LogP ≤ 5 | 15.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|