C14H22FN3 — CID 88534427
(1E,3Z)-1-(3-fluoro-4-propan-2-ylpiperidin-1-yl)hexa-1,3-dien-5-yne-1,4-diamine (PubChem CID 88534427) has the molecular formula C14H22FN3 and a molecular weight of 251.35 g/mol. Its IUPAC name is (1E,3Z)-1-(3-fluoro-4-propan-2-ylpiperidin-1-yl)hexa-1,3-dien-5-yne-1,4-diamine.
| Compound Name | (1E,3Z)-1-(3-fluoro-4-propan-2-ylpiperidin-1-yl)hexa-1,3-dien-5-yne-1,4-diamine |
|---|---|
| PubChem CID | 88534427 |
| Molecular Formula | C14H22FN3 |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.18 |
| IUPAC Name | (1E,3Z)-1-(3-fluoro-4-propan-2-ylpiperidin-1-yl)hexa-1,3-dien-5-yne-1,4-diamine |
| SMILES | C#C/C(N)=C/C=C(\N)N1CCC(C(C)C)C(F)C1 |
| InChI | InChI=1S/C14H22FN3/c1-4-11(16)5-6-14(17)18-8-7-12(10(2)3)13(15)9-18/h1,5-6,10,12-13H,7-9,16-17H2,2-3H3/b11-5-,14-6+ |
| InChIKey | DEBPIIOXXAOMAX-UDTAFQIDSA-N |
| XLogP | 1.58 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|