About 2-(1-adamantyl)-1,1-difluoroethanethiol
2-(1-adamantyl)-1,1-difluoroethanethiol (PubChem CID 88534942) has the molecular formula C12H18F2S
and a molecular weight of 232.34 g/mol. Its IUPAC name is 2-(1-adamantyl)-1,1-difluoroethanethiol.
Molecular Properties
| Compound Name | 2-(1-adamantyl)-1,1-difluoroethanethiol |
| PubChem CID | 88534942 |
| Molecular Formula | C12H18F2S |
| Molecular Weight | 232.34 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 2-(1-adamantyl)-1,1-difluoroethanethiol |
| SMILES | FC(F)(S)CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C12H18F2S/c13-12(14,15)7-11-4-8-1-9(5-11)3-10(2-8)6-11/h8-10,15H,1-7H2 |
| InChIKey | GRWKQCXCCHACDS-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.34 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-adamantyl)-1,1-difluoroethanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-adamantyl)-1,1-difluoroethanethiol?
The IUPAC name of 2-(1-adamantyl)-1,1-difluoroethanethiol (CID 88534942) is 2-(1-adamantyl)-1,1-difluoroethanethiol.
What is the SMILES notation for 2-(1-adamantyl)-1,1-difluoroethanethiol?
The canonical SMILES for 2-(1-adamantyl)-1,1-difluoroethanethiol is FC(F)(S)CC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 2-(1-adamantyl)-1,1-difluoroethanethiol?
The InChIKey is GRWKQCXCCHACDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18F2S/c13-12(14,15)7-11-4-8-1-9(5-11)3-10(2-8)6-11/h8-10,15H,1-7H2.
What are the key properties of 2-(1-adamantyl)-1,1-difluoroethanethiol?
2-(1-adamantyl)-1,1-difluoroethanethiol has a molecular weight of 232.34 g/mol, XLogP of 4.12, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-adamantyl)-1,1-difluoroethanethiol is sourced from PubChem (CID 88534942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).