About 4-methyl-1,2-dinitrocyclopentane
4-methyl-1,2-dinitrocyclopentane (PubChem CID 88534951) has the molecular formula C6H10N2O4
and a molecular weight of 174.16 g/mol. Its IUPAC name is 4-methyl-1,2-dinitrocyclopentane.
Molecular Properties
| Compound Name | 4-methyl-1,2-dinitrocyclopentane |
| PubChem CID | 88534951 |
| Molecular Formula | C6H10N2O4 |
| Molecular Weight | 174.16 g/mol |
| Exact Mass | 174.06 |
| IUPAC Name | 4-methyl-1,2-dinitrocyclopentane |
| SMILES | CC1CC([N+](=O)[O-])C([N+](=O)[O-])C1 |
| InChI | InChI=1S/C6H10N2O4/c1-4-2-5(7(9)10)6(3-4)8(11)12/h4-6H,2-3H2,1H3 |
| InChIKey | FYLHABLZMCEUFS-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.16 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-1,2-dinitrocyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1,2-dinitrocyclopentane?
The IUPAC name of 4-methyl-1,2-dinitrocyclopentane (CID 88534951) is 4-methyl-1,2-dinitrocyclopentane.
What is the SMILES notation for 4-methyl-1,2-dinitrocyclopentane?
The canonical SMILES for 4-methyl-1,2-dinitrocyclopentane is CC1CC([N+](=O)[O-])C([N+](=O)[O-])C1.
What is the InChIKey of 4-methyl-1,2-dinitrocyclopentane?
The InChIKey is FYLHABLZMCEUFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O4/c1-4-2-5(7(9)10)6(3-4)8(11)12/h4-6H,2-3H2,1H3.
What are the key properties of 4-methyl-1,2-dinitrocyclopentane?
4-methyl-1,2-dinitrocyclopentane has a molecular weight of 174.16 g/mol, XLogP of 0.71, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1,2-dinitrocyclopentane is sourced from PubChem (CID 88534951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).