C16H15N3O3 — CID 88535268
4-[(3Z,5E)-6-amino-5-nitrohexa-1,3,5-trien-2-yl]oxy-2-cyclopropylbenzonitrile (PubChem CID 88535268) has the molecular formula C16H15N3O3 and a molecular weight of 297.31 g/mol. Its IUPAC name is 4-[(3Z,5E)-6-amino-5-nitrohexa-1,3,5-trien-2-yl]oxy-2-cyclopropylbenzonitrile.
| Compound Name | 4-[(3Z,5E)-6-amino-5-nitrohexa-1,3,5-trien-2-yl]oxy-2-cyclopropylbenzonitrile |
|---|---|
| PubChem CID | 88535268 |
| Molecular Formula | C16H15N3O3 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 4-[(3Z,5E)-6-amino-5-nitrohexa-1,3,5-trien-2-yl]oxy-2-cyclopropylbenzonitrile |
| SMILES | C=C(/C=C\C(=C/N)[N+](=O)[O-])Oc1ccc(C#N)c(C2CC2)c1 |
| InChI | InChI=1S/C16H15N3O3/c1-11(2-6-14(10-18)19(20)21)22-15-7-5-13(9-17)16(8-15)12-3-4-12/h2,5-8,10,12H,1,3-4,18H2/b6-2-,14-10+ |
| InChIKey | SZKSIPWRFADHRO-VRKWNGLMSA-N |
| XLogP | 2.96 |
| TPSA | 102.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|