C22H48N2O4 — CID 88535327
N,N,N',N'-tetrakis(2-methylpropoxymethyl)ethane-1,2-diamine (PubChem CID 88535327) has the molecular formula C22H48N2O4 and a molecular weight of 404.64 g/mol. Its IUPAC name is N,N,N',N'-tetrakis(2-methylpropoxymethyl)ethane-1,2-diamine.
| Compound Name | N,N,N',N'-tetrakis(2-methylpropoxymethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 88535327 |
| Molecular Formula | C22H48N2O4 |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 404.36 |
| IUPAC Name | N,N,N',N'-tetrakis(2-methylpropoxymethyl)ethane-1,2-diamine |
| SMILES | CC(C)COCN(CCN(COCC(C)C)COCC(C)C)COCC(C)C |
| InChI | InChI=1S/C22H48N2O4/c1-19(2)11-25-15-23(16-26-12-20(3)4)9-10-24(17-27-13-21(5)6)18-28-14-22(7)8/h19-22H,9-18H2,1-8H3 |
| InChIKey | MDFQRCDVMVMDBH-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|