C20H25FN2O2 — CID 88535395
2-(1,2,2,3,3,4,5,5,6,6-decadeuterio-4-methylcyclohexanecarbonyl)-10-fluoro-3,6,7,11b-tetrahydro-1H-pyrazino[2,1-a]isoquinolin-4-one (PubChem CID 88535395) has the molecular formula C20H25FN2O2 and a molecular weight of 354.49 g/mol. Its IUPAC name is 2-(1,2,2,3,3,4,5,5,6,6-decadeuterio-4-methylcyclohexanecarbonyl)-10-fluoro-3,6,7,11b-tetrahydro-1H-pyrazino[2,1-a]isoquinolin-4-one.
| Compound Name | 2-(1,2,2,3,3,4,5,5,6,6-decadeuterio-4-methylcyclohexanecarbonyl)-10-fluoro-3,6,7,11b-tetrahydro-1H-pyrazino[2,1-a]isoquinolin-4-one |
|---|---|
| PubChem CID | 88535395 |
| Molecular Formula | C20H25FN2O2 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.25 |
| IUPAC Name | 2-(1,2,2,3,3,4,5,5,6,6-decadeuterio-4-methylcyclohexanecarbonyl)-10-fluoro-3,6,7,11b-tetrahydro-1H-pyrazino[2,1-a]isoquinolin-4-one |
| SMILES | [2H]C1([2H])C([2H])([2H])C([2H])(C(=O)N2CC(=O)N3CCc4ccc(F)cc4C3C2)C([2H])([2H])C([2H])([2H])C1([2H])C |
| InChI | InChI=1S/C20H25FN2O2/c1-13-2-4-15(5-3-13)20(25)22-11-18-17-10-16(21)7-6-14(17)8-9-23(18)19(24)12-22/h6-7,10,13,15,18H,2-5,8-9,11-12H2,1H3/i2D2,3D2,4D2,5D2,13D,15D |
| InChIKey | VNVZPCKOHOWRRO-ZKINZSRRSA-N |
| XLogP | 2.92 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |