About (2E,4Z)-6-iodo-3-(trifluoromethoxy)hepta-2,4-diene
(2E,4Z)-6-iodo-3-(trifluoromethoxy)hepta-2,4-diene (PubChem CID 88535524) has the molecular formula C8H10F3IO
and a molecular weight of 306.07 g/mol. Its IUPAC name is (2E,4Z)-6-iodo-3-(trifluoromethoxy)hepta-2,4-diene.
Molecular Properties
| Compound Name | (2E,4Z)-6-iodo-3-(trifluoromethoxy)hepta-2,4-diene |
| PubChem CID | 88535524 |
| Molecular Formula | C8H10F3IO |
| Molecular Weight | 306.07 g/mol |
| Exact Mass | 305.97 |
| IUPAC Name | (2E,4Z)-6-iodo-3-(trifluoromethoxy)hepta-2,4-diene |
| SMILES | C/C=C(\C=C/C(C)I)OC(F)(F)F |
| InChI | InChI=1S/C8H10F3IO/c1-3-7(5-4-6(2)12)13-8(9,10)11/h3-6H,1-2H3/b5-4-,7-3+ |
| InChIKey | BYWRLFWVKPOIPY-SBYNAHCQSA-N |
| XLogP | 3.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.07 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4Z)-6-iodo-3-(trifluoromethoxy)hepta-2,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4Z)-6-iodo-3-(trifluoromethoxy)hepta-2,4-diene?
The IUPAC name of (2E,4Z)-6-iodo-3-(trifluoromethoxy)hepta-2,4-diene (CID 88535524) is (2E,4Z)-6-iodo-3-(trifluoromethoxy)hepta-2,4-diene.
What is the SMILES notation for (2E,4Z)-6-iodo-3-(trifluoromethoxy)hepta-2,4-diene?
The canonical SMILES for (2E,4Z)-6-iodo-3-(trifluoromethoxy)hepta-2,4-diene is C/C=C(\C=C/C(C)I)OC(F)(F)F.
What is the InChIKey of (2E,4Z)-6-iodo-3-(trifluoromethoxy)hepta-2,4-diene?
The InChIKey is BYWRLFWVKPOIPY-SBYNAHCQSA-N. The full InChI is InChI=1S/C8H10F3IO/c1-3-7(5-4-6(2)12)13-8(9,10)11/h3-6H,1-2H3/b5-4-,7-3+.
What are the key properties of (2E,4Z)-6-iodo-3-(trifluoromethoxy)hepta-2,4-diene?
(2E,4Z)-6-iodo-3-(trifluoromethoxy)hepta-2,4-diene has a molecular weight of 306.07 g/mol, XLogP of 3.81, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4Z)-6-iodo-3-(trifluoromethoxy)hepta-2,4-diene is sourced from PubChem (CID 88535524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).