C26H35ClN2O5Si — CID 88536922
(2R,5R)-2-[(R)-[tert-butyl(dimethyl)silyl]oxy-(6-chloro-3-pyridinyl)methyl]-5-[(4-methoxycarbonylphenyl)methyl]pyrrolidine-1-carboxylic acid (PubChem CID 88536922) has the molecular formula C26H35ClN2O5Si and a molecular weight of 519.11 g/mol. Its IUPAC name is (2R,5R)-2-[(R)-[tert-butyl(dimethyl)silyl]oxy-(6-chloro-3-pyridinyl)methyl]-5-[(4-methoxycarbonylphenyl)methyl]pyrrolidine-1-carboxylic acid.
| Compound Name | (2R,5R)-2-[(R)-[tert-butyl(dimethyl)silyl]oxy-(6-chloro-3-pyridinyl)methyl]-5-[(4-methoxycarbonylphenyl)methyl]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 88536922 |
| Molecular Formula | C26H35ClN2O5Si |
| Molecular Weight | 519.11 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | (2R,5R)-2-[(R)-[tert-butyl(dimethyl)silyl]oxy-(6-chloro-3-pyridinyl)methyl]-5-[(4-methoxycarbonylphenyl)methyl]pyrrolidine-1-carboxylic acid |
| SMILES | COC(=O)c1ccc(C[C@H]2CC[C@H]([C@H](O[Si](C)(C)C(C)(C)C)c3ccc(Cl)nc3)N2C(=O)O)cc1 |
| InChI | InChI=1S/C26H35ClN2O5Si/c1-26(2,3)35(5,6)34-23(19-11-14-22(27)28-16-19)21-13-12-20(29(21)25(31)32)15-17-7-9-18(10-8-17)24(30)33-4/h7-11,14,16,20-21,23H,12-13,15H2,1-6H3,(H,31,32)/t20-,21-,23-/m1/s1 |
| InChIKey | YRRKDNSDGBIZPQ-MQSCRBSSSA-N |
| XLogP | 6.34 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.11 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|