About prop-2-ene-1-sulfonate;trimethyl(octyl)azanium
prop-2-ene-1-sulfonate;trimethyl(octyl)azanium (PubChem CID 88536949) has the molecular formula C14H31NO3S
and a molecular weight of 293.47 g/mol. Its IUPAC name is prop-2-ene-1-sulfonate;trimethyl(octyl)azanium.
Molecular Properties
| Compound Name | prop-2-ene-1-sulfonate;trimethyl(octyl)azanium |
| PubChem CID | 88536949 |
| Molecular Formula | C14H31NO3S |
| Molecular Weight | 293.47 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | prop-2-ene-1-sulfonate;trimethyl(octyl)azanium |
| SMILES | C=CCS(=O)(=O)[O-].CCCCCCCC[N+](C)(C)C |
| InChI | InChI=1S/C11H26N.C3H6O3S/c1-5-6-7-8-9-10-11-12(2,3)4;1-2-3-7(4,5)6/h5-11H2,1-4H3;2H,1,3H2,(H,4,5,6)/q+1;/p-1 |
| InChIKey | TUNBDZLQBWZOEK-UHFFFAOYSA-M |
| XLogP | 2.77 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.47 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze prop-2-ene-1-sulfonate;trimethyl(octyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-ene-1-sulfonate;trimethyl(octyl)azanium?
The IUPAC name of prop-2-ene-1-sulfonate;trimethyl(octyl)azanium (CID 88536949) is prop-2-ene-1-sulfonate;trimethyl(octyl)azanium.
What is the SMILES notation for prop-2-ene-1-sulfonate;trimethyl(octyl)azanium?
The canonical SMILES for prop-2-ene-1-sulfonate;trimethyl(octyl)azanium is C=CCS(=O)(=O)[O-].CCCCCCCC[N+](C)(C)C.
What is the InChIKey of prop-2-ene-1-sulfonate;trimethyl(octyl)azanium?
The InChIKey is TUNBDZLQBWZOEK-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H26N.C3H6O3S/c1-5-6-7-8-9-10-11-12(2,3)4;1-2-3-7(4,5)6/h5-11H2,1-4H3;2H,1,3H2,(H,4,5,6)/q+1;/p-1.
What are the key properties of prop-2-ene-1-sulfonate;trimethyl(octyl)azanium?
prop-2-ene-1-sulfonate;trimethyl(octyl)azanium has a molecular weight of 293.47 g/mol, XLogP of 2.77, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-ene-1-sulfonate;trimethyl(octyl)azanium is sourced from PubChem (CID 88536949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).