About 1-ethyl-1-methylpiperidin-1-ium;prop-2-ene-1-sulfonate
1-ethyl-1-methylpiperidin-1-ium;prop-2-ene-1-sulfonate (PubChem CID 88536966) has the molecular formula C11H23NO3S
and a molecular weight of 249.38 g/mol. Its IUPAC name is 1-ethyl-1-methylpiperidin-1-ium;prop-2-ene-1-sulfonate.
Molecular Properties
| Compound Name | 1-ethyl-1-methylpiperidin-1-ium;prop-2-ene-1-sulfonate |
| PubChem CID | 88536966 |
| Molecular Formula | C11H23NO3S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 1-ethyl-1-methylpiperidin-1-ium;prop-2-ene-1-sulfonate |
| SMILES | C=CCS(=O)(=O)[O-].CC[N+]1(C)CCCCC1 |
| InChI | InChI=1S/C8H18N.C3H6O3S/c1-3-9(2)7-5-4-6-8-9;1-2-3-7(4,5)6/h3-8H2,1-2H3;2H,1,3H2,(H,4,5,6)/q+1;/p-1 |
| InChIKey | JLUVYLFFEKOLDZ-UHFFFAOYSA-M |
| XLogP | 1.35 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-1-methylpiperidin-1-ium;prop-2-ene-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-1-methylpiperidin-1-ium;prop-2-ene-1-sulfonate?
The IUPAC name of 1-ethyl-1-methylpiperidin-1-ium;prop-2-ene-1-sulfonate (CID 88536966) is 1-ethyl-1-methylpiperidin-1-ium;prop-2-ene-1-sulfonate.
What is the SMILES notation for 1-ethyl-1-methylpiperidin-1-ium;prop-2-ene-1-sulfonate?
The canonical SMILES for 1-ethyl-1-methylpiperidin-1-ium;prop-2-ene-1-sulfonate is C=CCS(=O)(=O)[O-].CC[N+]1(C)CCCCC1.
What is the InChIKey of 1-ethyl-1-methylpiperidin-1-ium;prop-2-ene-1-sulfonate?
The InChIKey is JLUVYLFFEKOLDZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H18N.C3H6O3S/c1-3-9(2)7-5-4-6-8-9;1-2-3-7(4,5)6/h3-8H2,1-2H3;2H,1,3H2,(H,4,5,6)/q+1;/p-1.
What are the key properties of 1-ethyl-1-methylpiperidin-1-ium;prop-2-ene-1-sulfonate?
1-ethyl-1-methylpiperidin-1-ium;prop-2-ene-1-sulfonate has a molecular weight of 249.38 g/mol, XLogP of 1.35, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-1-methylpiperidin-1-ium;prop-2-ene-1-sulfonate is sourced from PubChem (CID 88536966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).