C31H29ClF7N3O2 — CID 88537059
4-cyclopropyl-6-methyl-N-phenylpyrimidin-2-amine;(2,3,5,6-tetrafluoro-4-methylphenyl)methyl 3-[(Z)-2-chloro-3,3,3-trifluoroprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 88537059) has the molecular formula C31H29ClF7N3O2 and a molecular weight of 644.03 g/mol. Its IUPAC name is 4-cyclopropyl-6-methyl-N-phenylpyrimidin-2-amine;(2,3,5,6-tetrafluoro-4-methylphenyl)methyl 3-[(Z)-2-chloro-3,3,3-trifluoroprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | 4-cyclopropyl-6-methyl-N-phenylpyrimidin-2-amine;(2,3,5,6-tetrafluoro-4-methylphenyl)methyl 3-[(Z)-2-chloro-3,3,3-trifluoroprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 88537059 |
| Molecular Formula | C31H29ClF7N3O2 |
| Molecular Weight | 644.03 g/mol |
| Exact Mass | 643.18 |
| IUPAC Name | 4-cyclopropyl-6-methyl-N-phenylpyrimidin-2-amine;(2,3,5,6-tetrafluoro-4-methylphenyl)methyl 3-[(Z)-2-chloro-3,3,3-trifluoroprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | Cc1c(F)c(F)c(COC(=O)C2C(/C=C(\Cl)C(F)(F)F)C2(C)C)c(F)c1F.Cc1cc(C2CC2)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C17H14ClF7O2.C14H15N3/c1-6-11(19)13(21)7(14(22)12(6)20)5-27-15(26)10-8(16(10,2)3)4-9(18)17(23,24)25;1-10-9-13(11-7-8-11)17-14(15-10)16-12-5-3-2-4-6-12/h4,8,10H,5H2,1-3H3;2-6,9,11H,7-8H2,1H3,(H,15,16,17)/b9-4-; |
| InChIKey | KUUJACDISAYIKY-WONROIIJSA-N |
| XLogP | 8.96 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.03 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|