C21H30N2O6S2 — CID 88537108
1-[(3,5-dimethylpyridin-1-ium-1-yl)methyl]-3,5-dimethylpyridin-1-ium;bis(prop-2-ene-1-sulfonate) (PubChem CID 88537108) has the molecular formula C21H30N2O6S2 and a molecular weight of 470.61 g/mol. Its IUPAC name is 1-[(3,5-dimethylpyridin-1-ium-1-yl)methyl]-3,5-dimethylpyridin-1-ium;bis(prop-2-ene-1-sulfonate).
| Compound Name | 1-[(3,5-dimethylpyridin-1-ium-1-yl)methyl]-3,5-dimethylpyridin-1-ium;bis(prop-2-ene-1-sulfonate) |
|---|---|
| PubChem CID | 88537108 |
| Molecular Formula | C21H30N2O6S2 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 1-[(3,5-dimethylpyridin-1-ium-1-yl)methyl]-3,5-dimethylpyridin-1-ium;bis(prop-2-ene-1-sulfonate) |
| SMILES | C=CCS(=O)(=O)[O-].C=CCS(=O)(=O)[O-].Cc1cc(C)c[n+](C[n+]2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C15H20N2.2C3H6O3S/c1-12-5-13(2)8-16(7-12)11-17-9-14(3)6-15(4)10-17;2*1-2-3-7(4,5)6/h5-10H,11H2,1-4H3;2*2H,1,3H2,(H,4,5,6)/q+2;;/p-2 |
| InChIKey | JOGQHEJTKNPEPQ-UHFFFAOYSA-L |
| XLogP | 1.44 |
| TPSA | 122.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|