About cyclohexene-1-sulfonate;1-ethyl-1-methylpiperidin-1-ium
cyclohexene-1-sulfonate;1-ethyl-1-methylpiperidin-1-ium (PubChem CID 88537123) has the molecular formula C14H27NO3S
and a molecular weight of 289.44 g/mol. Its IUPAC name is cyclohexene-1-sulfonate;1-ethyl-1-methylpiperidin-1-ium.
Molecular Properties
| Compound Name | cyclohexene-1-sulfonate;1-ethyl-1-methylpiperidin-1-ium |
| PubChem CID | 88537123 |
| Molecular Formula | C14H27NO3S |
| Molecular Weight | 289.44 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | cyclohexene-1-sulfonate;1-ethyl-1-methylpiperidin-1-ium |
| SMILES | CC[N+]1(C)CCCCC1.O=S(=O)([O-])C1=CCCCC1 |
| InChI | InChI=1S/C8H18N.C6H10O3S/c1-3-9(2)7-5-4-6-8-9;7-10(8,9)6-4-2-1-3-5-6/h3-8H2,1-2H3;4H,1-3,5H2,(H,7,8,9)/q+1;/p-1 |
| InChIKey | QXAFCAUEBOHYIH-UHFFFAOYSA-M |
| XLogP | 2.63 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.44 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze cyclohexene-1-sulfonate;1-ethyl-1-methylpiperidin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexene-1-sulfonate;1-ethyl-1-methylpiperidin-1-ium?
The IUPAC name of cyclohexene-1-sulfonate;1-ethyl-1-methylpiperidin-1-ium (CID 88537123) is cyclohexene-1-sulfonate;1-ethyl-1-methylpiperidin-1-ium.
What is the SMILES notation for cyclohexene-1-sulfonate;1-ethyl-1-methylpiperidin-1-ium?
The canonical SMILES for cyclohexene-1-sulfonate;1-ethyl-1-methylpiperidin-1-ium is CC[N+]1(C)CCCCC1.O=S(=O)([O-])C1=CCCCC1.
What is the InChIKey of cyclohexene-1-sulfonate;1-ethyl-1-methylpiperidin-1-ium?
The InChIKey is QXAFCAUEBOHYIH-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H18N.C6H10O3S/c1-3-9(2)7-5-4-6-8-9;7-10(8,9)6-4-2-1-3-5-6/h3-8H2,1-2H3;4H,1-3,5H2,(H,7,8,9)/q+1;/p-1.
What are the key properties of cyclohexene-1-sulfonate;1-ethyl-1-methylpiperidin-1-ium?
cyclohexene-1-sulfonate;1-ethyl-1-methylpiperidin-1-ium has a molecular weight of 289.44 g/mol, XLogP of 2.63, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexene-1-sulfonate;1-ethyl-1-methylpiperidin-1-ium is sourced from PubChem (CID 88537123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).