About but-3-ene-1-sulfonate;tributyl(methyl)azanium
but-3-ene-1-sulfonate;tributyl(methyl)azanium (PubChem CID 88537162) has the molecular formula C17H37NO3S
and a molecular weight of 335.55 g/mol. Its IUPAC name is but-3-ene-1-sulfonate;tributyl(methyl)azanium.
Molecular Properties
| Compound Name | but-3-ene-1-sulfonate;tributyl(methyl)azanium |
| PubChem CID | 88537162 |
| Molecular Formula | C17H37NO3S |
| Molecular Weight | 335.55 g/mol |
| Exact Mass | 335.25 |
| IUPAC Name | but-3-ene-1-sulfonate;tributyl(methyl)azanium |
| SMILES | C=CCCS(=O)(=O)[O-].CCCC[N+](C)(CCCC)CCCC |
| InChI | InChI=1S/C13H30N.C4H8O3S/c1-5-8-11-14(4,12-9-6-2)13-10-7-3;1-2-3-4-8(5,6)7/h5-13H2,1-4H3;2H,1,3-4H2,(H,5,6,7)/q+1;/p-1 |
| InChIKey | YDTUMEWFESGWQU-UHFFFAOYSA-M |
| XLogP | 3.94 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.55 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze but-3-ene-1-sulfonate;tributyl(methyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-ene-1-sulfonate;tributyl(methyl)azanium?
The IUPAC name of but-3-ene-1-sulfonate;tributyl(methyl)azanium (CID 88537162) is but-3-ene-1-sulfonate;tributyl(methyl)azanium.
What is the SMILES notation for but-3-ene-1-sulfonate;tributyl(methyl)azanium?
The canonical SMILES for but-3-ene-1-sulfonate;tributyl(methyl)azanium is C=CCCS(=O)(=O)[O-].CCCC[N+](C)(CCCC)CCCC.
What is the InChIKey of but-3-ene-1-sulfonate;tributyl(methyl)azanium?
The InChIKey is YDTUMEWFESGWQU-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H30N.C4H8O3S/c1-5-8-11-14(4,12-9-6-2)13-10-7-3;1-2-3-4-8(5,6)7/h5-13H2,1-4H3;2H,1,3-4H2,(H,5,6,7)/q+1;/p-1.
What are the key properties of but-3-ene-1-sulfonate;tributyl(methyl)azanium?
but-3-ene-1-sulfonate;tributyl(methyl)azanium has a molecular weight of 335.55 g/mol, XLogP of 3.94, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-ene-1-sulfonate;tributyl(methyl)azanium is sourced from PubChem (CID 88537162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).