C26H31Cl2N7OS — CID 88537260
1-(4-chlorophenyl)-4,4-dimethyl-3-(1,2,4-triazol-1-ylmethyl)pentan-3-ol;[3-[(6-chloro-3-pyridinyl)methyl]-1,3-thiazolidin-2-ylidene]cyanamide (PubChem CID 88537260) has the molecular formula C26H31Cl2N7OS and a molecular weight of 560.56 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-4,4-dimethyl-3-(1,2,4-triazol-1-ylmethyl)pentan-3-ol;[3-[(6-chloro-3-pyridinyl)methyl]-1,3-thiazolidin-2-ylidene]cyanamide.
| Compound Name | 1-(4-chlorophenyl)-4,4-dimethyl-3-(1,2,4-triazol-1-ylmethyl)pentan-3-ol;[3-[(6-chloro-3-pyridinyl)methyl]-1,3-thiazolidin-2-ylidene]cyanamide |
|---|---|
| PubChem CID | 88537260 |
| Molecular Formula | C26H31Cl2N7OS |
| Molecular Weight | 560.56 g/mol |
| Exact Mass | 559.17 |
| IUPAC Name | 1-(4-chlorophenyl)-4,4-dimethyl-3-(1,2,4-triazol-1-ylmethyl)pentan-3-ol;[3-[(6-chloro-3-pyridinyl)methyl]-1,3-thiazolidin-2-ylidene]cyanamide |
| SMILES | CC(C)(C)C(O)(CCc1ccc(Cl)cc1)Cn1cncn1.N#C/N=C1\SCCN1Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C16H22ClN3O.C10H9ClN4S/c1-15(2,3)16(21,10-20-12-18-11-19-20)9-8-13-4-6-14(17)7-5-13;11-9-2-1-8(5-13-9)6-15-3-4-16-10(15)14-7-12/h4-7,11-12,21H,8-10H2,1-3H3;1-2,5H,3-4,6H2/b;14-10- |
| InChIKey | BYSWJCSNCHKDLN-KVIVADCXSA-N |
| XLogP | 5.46 |
| TPSA | 103.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.56 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|