C18H12O — CID 88537838
pentacyclo[9.7.0.02,7.07,9.012,16]octadeca-1,3,5,8,10,13,15,17-octaen-5-ol (PubChem CID 88537838) has the molecular formula C18H12O and a molecular weight of 244.29 g/mol. Its IUPAC name is pentacyclo[9.7.0.02,7.07,9.012,16]octadeca-1,3,5,8,10,13,15,17-octaen-5-ol.
| Compound Name | pentacyclo[9.7.0.02,7.07,9.012,16]octadeca-1,3,5,8,10,13,15,17-octaen-5-ol |
|---|---|
| PubChem CID | 88537838 |
| Molecular Formula | C18H12O |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | pentacyclo[9.7.0.02,7.07,9.012,16]octadeca-1,3,5,8,10,13,15,17-octaen-5-ol |
| SMILES | OC1=CC23C=C2C=C2C(=C3C=C1)C=CC1=CC=CC12 |
| InChI | InChI=1S/C18H12O/c19-13-5-7-17-15-6-4-11-2-1-3-14(11)16(15)8-12-9-18(12,17)10-13/h1-10,14,19H |
| InChIKey | RRUSGEMKCSZLLN-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |