About 1-(2,2,2-trifluoroethoxy)propan-2-yl 2-methoxypropanoate
1-(2,2,2-trifluoroethoxy)propan-2-yl 2-methoxypropanoate (PubChem CID 88537906) has the molecular formula C9H15F3O4
and a molecular weight of 244.21 g/mol. Its IUPAC name is 1-(2,2,2-trifluoroethoxy)propan-2-yl 2-methoxypropanoate.
Molecular Properties
| Compound Name | 1-(2,2,2-trifluoroethoxy)propan-2-yl 2-methoxypropanoate |
| PubChem CID | 88537906 |
| Molecular Formula | C9H15F3O4 |
| Molecular Weight | 244.21 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 1-(2,2,2-trifluoroethoxy)propan-2-yl 2-methoxypropanoate |
| SMILES | COC(C)C(=O)OC(C)COCC(F)(F)F |
| InChI | InChI=1S/C9H15F3O4/c1-6(4-15-5-9(10,11)12)16-8(13)7(2)14-3/h6-7H,4-5H2,1-3H3 |
| InChIKey | JUDGVVQKOCBBMM-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.21 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2,2,2-trifluoroethoxy)propan-2-yl 2-methoxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2,2-trifluoroethoxy)propan-2-yl 2-methoxypropanoate?
The IUPAC name of 1-(2,2,2-trifluoroethoxy)propan-2-yl 2-methoxypropanoate (CID 88537906) is 1-(2,2,2-trifluoroethoxy)propan-2-yl 2-methoxypropanoate.
What is the SMILES notation for 1-(2,2,2-trifluoroethoxy)propan-2-yl 2-methoxypropanoate?
The canonical SMILES for 1-(2,2,2-trifluoroethoxy)propan-2-yl 2-methoxypropanoate is COC(C)C(=O)OC(C)COCC(F)(F)F.
What is the InChIKey of 1-(2,2,2-trifluoroethoxy)propan-2-yl 2-methoxypropanoate?
The InChIKey is JUDGVVQKOCBBMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F3O4/c1-6(4-15-5-9(10,11)12)16-8(13)7(2)14-3/h6-7H,4-5H2,1-3H3.
What are the key properties of 1-(2,2,2-trifluoroethoxy)propan-2-yl 2-methoxypropanoate?
1-(2,2,2-trifluoroethoxy)propan-2-yl 2-methoxypropanoate has a molecular weight of 244.21 g/mol, XLogP of 1.53, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2,2-trifluoroethoxy)propan-2-yl 2-methoxypropanoate is sourced from PubChem (CID 88537906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).