C12H19N5O8S — CID 88537966
4-(3,5-dinitro-2-pyridinyl)-1,1-dimethylpiperazin-1-ium;methyl sulfate (PubChem CID 88537966) has the molecular formula C12H19N5O8S and a molecular weight of 393.38 g/mol. Its IUPAC name is 4-(3,5-dinitro-2-pyridinyl)-1,1-dimethylpiperazin-1-ium;methyl sulfate.
| Compound Name | 4-(3,5-dinitro-2-pyridinyl)-1,1-dimethylpiperazin-1-ium;methyl sulfate |
|---|---|
| PubChem CID | 88537966 |
| Molecular Formula | C12H19N5O8S |
| Molecular Weight | 393.38 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 4-(3,5-dinitro-2-pyridinyl)-1,1-dimethylpiperazin-1-ium;methyl sulfate |
| SMILES | COS(=O)(=O)[O-].C[N+]1(C)CCN(c2ncc([N+](=O)[O-])cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C11H16N5O4.CH4O4S/c1-16(2)5-3-13(4-6-16)11-10(15(19)20)7-9(8-12-11)14(17)18;1-5-6(2,3)4/h7-8H,3-6H2,1-2H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | KXJRYBLFSZALKU-UHFFFAOYSA-M |
| XLogP | -0.11 |
| TPSA | 168.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.38 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|