C23H27Cl2F2N5OS — CID 88538233
N-[[3-[[2-amino-5-chloro-4-(3,3-difluoropyrrolidin-1-yl)phenyl]carbamothioylamino]-4-chlorophenyl]methyl]-2,2-dimethylpropanamide (PubChem CID 88538233) has the molecular formula C23H27Cl2F2N5OS and a molecular weight of 530.47 g/mol. Its IUPAC name is N-[[3-[[2-amino-5-chloro-4-(3,3-difluoropyrrolidin-1-yl)phenyl]carbamothioylamino]-4-chlorophenyl]methyl]-2,2-dimethylpropanamide.
| Compound Name | N-[[3-[[2-amino-5-chloro-4-(3,3-difluoropyrrolidin-1-yl)phenyl]carbamothioylamino]-4-chlorophenyl]methyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 88538233 |
| Molecular Formula | C23H27Cl2F2N5OS |
| Molecular Weight | 530.47 g/mol |
| Exact Mass | 529.13 |
| IUPAC Name | N-[[3-[[2-amino-5-chloro-4-(3,3-difluoropyrrolidin-1-yl)phenyl]carbamothioylamino]-4-chlorophenyl]methyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NCc1ccc(Cl)c(NC(=S)Nc2cc(Cl)c(N3CCC(F)(F)C3)cc2N)c1 |
| InChI | InChI=1S/C23H27Cl2F2N5OS/c1-22(2,3)20(33)29-11-13-4-5-14(24)17(8-13)30-21(34)31-18-9-15(25)19(10-16(18)28)32-7-6-23(26,27)12-32/h4-5,8-10H,6-7,11-12,28H2,1-3H3,(H,29,33)(H2,30,31,34) |
| InChIKey | HINBTEAUDATRAH-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 82.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.47 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|