About 2-butyl-5-isocyanato-1,3-benzodioxole
2-butyl-5-isocyanato-1,3-benzodioxole (PubChem CID 88538325) has the molecular formula C12H13NO3
and a molecular weight of 219.24 g/mol. Its IUPAC name is 2-butyl-5-isocyanato-1,3-benzodioxole.
Molecular Properties
| Compound Name | 2-butyl-5-isocyanato-1,3-benzodioxole |
| PubChem CID | 88538325 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 2-butyl-5-isocyanato-1,3-benzodioxole |
| SMILES | CCCCC1Oc2ccc(N=C=O)cc2O1 |
| InChI | InChI=1S/C12H13NO3/c1-2-3-4-12-15-10-6-5-9(13-8-14)7-11(10)16-12/h5-7,12H,2-4H2,1H3 |
| InChIKey | GKTCXWUUSQVEDD-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2-butyl-5-isocyanato-1,3-benzodioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-5-isocyanato-1,3-benzodioxole?
The IUPAC name of 2-butyl-5-isocyanato-1,3-benzodioxole (CID 88538325) is 2-butyl-5-isocyanato-1,3-benzodioxole.
What is the SMILES notation for 2-butyl-5-isocyanato-1,3-benzodioxole?
The canonical SMILES for 2-butyl-5-isocyanato-1,3-benzodioxole is CCCCC1Oc2ccc(N=C=O)cc2O1.
What is the InChIKey of 2-butyl-5-isocyanato-1,3-benzodioxole?
The InChIKey is GKTCXWUUSQVEDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO3/c1-2-3-4-12-15-10-6-5-9(13-8-14)7-11(10)16-12/h5-7,12H,2-4H2,1H3.
What are the key properties of 2-butyl-5-isocyanato-1,3-benzodioxole?
2-butyl-5-isocyanato-1,3-benzodioxole has a molecular weight of 219.24 g/mol, XLogP of 2.94, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-5-isocyanato-1,3-benzodioxole is sourced from PubChem (CID 88538325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).