C20H20ClFN6O — CID 88538331
3-[[5-chloro-1-(4-fluorobutyl)imidazo[4,5-b]pyridin-2-yl]methyl]-1-cyclopropylimidazo[4,5-c]pyridin-2-one (PubChem CID 88538331) has the molecular formula C20H20ClFN6O and a molecular weight of 414.87 g/mol. Its IUPAC name is 3-[[5-chloro-1-(4-fluorobutyl)imidazo[4,5-b]pyridin-2-yl]methyl]-1-cyclopropylimidazo[4,5-c]pyridin-2-one.
| Compound Name | 3-[[5-chloro-1-(4-fluorobutyl)imidazo[4,5-b]pyridin-2-yl]methyl]-1-cyclopropylimidazo[4,5-c]pyridin-2-one |
|---|---|
| PubChem CID | 88538331 |
| Molecular Formula | C20H20ClFN6O |
| Molecular Weight | 414.87 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 3-[[5-chloro-1-(4-fluorobutyl)imidazo[4,5-b]pyridin-2-yl]methyl]-1-cyclopropylimidazo[4,5-c]pyridin-2-one |
| SMILES | O=c1n(Cc2nc3nc(Cl)ccc3n2CCCCF)c2cnccc2n1C1CC1 |
| InChI | InChI=1S/C20H20ClFN6O/c21-17-6-5-15-19(24-17)25-18(26(15)10-2-1-8-22)12-27-16-11-23-9-7-14(16)28(20(27)29)13-3-4-13/h5-7,9,11,13H,1-4,8,10,12H2 |
| InChIKey | KPVUDMBBQWQGGJ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 70.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.87 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|