About tert-butyl N-[1,3-bis(1,3-dioxoisoindol-2-yl)propan-2-yloxy]-N-ethylcarbamate
tert-butyl N-[1,3-bis(1,3-dioxoisoindol-2-yl)propan-2-yloxy]-N-ethylcarbamate (PubChem CID 88538398) has the molecular formula C26H27N3O7
and a molecular weight of 493.52 g/mol. Its IUPAC name is tert-butyl N-[1,3-bis(1,3-dioxoisoindol-2-yl)propan-2-yloxy]-N-ethylcarbamate.
Molecular Properties
| Compound Name | tert-butyl N-[1,3-bis(1,3-dioxoisoindol-2-yl)propan-2-yloxy]-N-ethylcarbamate |
| PubChem CID | 88538398 |
| Molecular Formula | C26H27N3O7 |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | tert-butyl N-[1,3-bis(1,3-dioxoisoindol-2-yl)propan-2-yloxy]-N-ethylcarbamate |
| SMILES | CCN(OC(CN1C(=O)c2ccccc2C1=O)CN1C(=O)c2ccccc2C1=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H27N3O7/c1-5-29(25(34)35-26(2,3)4)36-16(14-27-21(30)17-10-6-7-11-18(17)22(27)31)15-28-23(32)19-12-8-9-13-20(19)24(28)33/h6-13,16H,5,14-15H2,1-4H3 |
| InChIKey | NJEWMTQCAACRLS-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 113.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[1,3-bis(1,3-dioxoisoindol-2-yl)propan-2-yloxy]-N-ethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[1,3-bis(1,3-dioxoisoindol-2-yl)propan-2-yloxy]-N-ethylcarbamate?
The IUPAC name of tert-butyl N-[1,3-bis(1,3-dioxoisoindol-2-yl)propan-2-yloxy]-N-ethylcarbamate (CID 88538398) is tert-butyl N-[1,3-bis(1,3-dioxoisoindol-2-yl)propan-2-yloxy]-N-ethylcarbamate.
What is the SMILES notation for tert-butyl N-[1,3-bis(1,3-dioxoisoindol-2-yl)propan-2-yloxy]-N-ethylcarbamate?
The canonical SMILES for tert-butyl N-[1,3-bis(1,3-dioxoisoindol-2-yl)propan-2-yloxy]-N-ethylcarbamate is CCN(OC(CN1C(=O)c2ccccc2C1=O)CN1C(=O)c2ccccc2C1=O)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-[1,3-bis(1,3-dioxoisoindol-2-yl)propan-2-yloxy]-N-ethylcarbamate?
The InChIKey is NJEWMTQCAACRLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H27N3O7/c1-5-29(25(34)35-26(2,3)4)36-16(14-27-21(30)17-10-6-7-11-18(17)22(27)31)15-28-23(32)19-12-8-9-13-20(19)24(28)33/h6-13,16H,5,14-15H2,1-4H3.
What are the key properties of tert-butyl N-[1,3-bis(1,3-dioxoisoindol-2-yl)propan-2-yloxy]-N-ethylcarbamate?
tert-butyl N-[1,3-bis(1,3-dioxoisoindol-2-yl)propan-2-yloxy]-N-ethylcarbamate has a molecular weight of 493.52 g/mol, XLogP of 3.14, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[1,3-bis(1,3-dioxoisoindol-2-yl)propan-2-yloxy]-N-ethylcarbamate is sourced from PubChem (CID 88538398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).