C26H27N3O7 — CID 88538398
tert-butyl N-[1,3-bis(1,3-dioxoisoindol-2-yl)propan-2-yloxy]-N-ethylcarbamate (PubChem CID 88538398) has the molecular formula C26H27N3O7 and a molecular weight of 493.52 g/mol. Its IUPAC name is tert-butyl N-[1,3-bis(1,3-dioxoisoindol-2-yl)propan-2-yloxy]-N-ethylcarbamate.
| Compound Name | tert-butyl N-[1,3-bis(1,3-dioxoisoindol-2-yl)propan-2-yloxy]-N-ethylcarbamate |
|---|---|
| PubChem CID | 88538398 |
| Molecular Formula | C26H27N3O7 |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | tert-butyl N-[1,3-bis(1,3-dioxoisoindol-2-yl)propan-2-yloxy]-N-ethylcarbamate |
| SMILES | CCN(OC(CN1C(=O)c2ccccc2C1=O)CN1C(=O)c2ccccc2C1=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H27N3O7/c1-5-29(25(34)35-26(2,3)4)36-16(14-27-21(30)17-10-6-7-11-18(17)22(27)31)15-28-23(32)19-12-8-9-13-20(19)24(28)33/h6-13,16H,5,14-15H2,1-4H3 |
| InChIKey | NJEWMTQCAACRLS-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 113.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|