About N-[4,5-dichloro-2-(methylamino)phenyl]-N-methylhydroxylamine
N-[4,5-dichloro-2-(methylamino)phenyl]-N-methylhydroxylamine (PubChem CID 88538409) has the molecular formula C8H10Cl2N2O
and a molecular weight of 221.09 g/mol. Its IUPAC name is N-[4,5-dichloro-2-(methylamino)phenyl]-N-methylhydroxylamine.
Molecular Properties
| Compound Name | N-[4,5-dichloro-2-(methylamino)phenyl]-N-methylhydroxylamine |
| PubChem CID | 88538409 |
| Molecular Formula | C8H10Cl2N2O |
| Molecular Weight | 221.09 g/mol |
| Exact Mass | 220.02 |
| IUPAC Name | N-[4,5-dichloro-2-(methylamino)phenyl]-N-methylhydroxylamine |
| SMILES | CNc1cc(Cl)c(Cl)cc1N(C)O |
| InChI | InChI=1S/C8H10Cl2N2O/c1-11-7-3-5(9)6(10)4-8(7)12(2)13/h3-4,11,13H,1-2H3 |
| InChIKey | ZYCGKWPTIUQXHX-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.09 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[4,5-dichloro-2-(methylamino)phenyl]-N-methylhydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4,5-dichloro-2-(methylamino)phenyl]-N-methylhydroxylamine?
The IUPAC name of N-[4,5-dichloro-2-(methylamino)phenyl]-N-methylhydroxylamine (CID 88538409) is N-[4,5-dichloro-2-(methylamino)phenyl]-N-methylhydroxylamine.
What is the SMILES notation for N-[4,5-dichloro-2-(methylamino)phenyl]-N-methylhydroxylamine?
The canonical SMILES for N-[4,5-dichloro-2-(methylamino)phenyl]-N-methylhydroxylamine is CNc1cc(Cl)c(Cl)cc1N(C)O.
What is the InChIKey of N-[4,5-dichloro-2-(methylamino)phenyl]-N-methylhydroxylamine?
The InChIKey is ZYCGKWPTIUQXHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10Cl2N2O/c1-11-7-3-5(9)6(10)4-8(7)12(2)13/h3-4,11,13H,1-2H3.
What are the key properties of N-[4,5-dichloro-2-(methylamino)phenyl]-N-methylhydroxylamine?
N-[4,5-dichloro-2-(methylamino)phenyl]-N-methylhydroxylamine has a molecular weight of 221.09 g/mol, XLogP of 2.86, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4,5-dichloro-2-(methylamino)phenyl]-N-methylhydroxylamine is sourced from PubChem (CID 88538409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).