C9H11F3 — CID 88539062
(3E)-2,3,5-trifluoro-4-propan-2-ylhexa-1,3,5-triene (PubChem CID 88539062) has the molecular formula C9H11F3 and a molecular weight of 176.18 g/mol. Its IUPAC name is (3E)-2,3,5-trifluoro-4-propan-2-ylhexa-1,3,5-triene.
| Compound Name | (3E)-2,3,5-trifluoro-4-propan-2-ylhexa-1,3,5-triene |
|---|---|
| PubChem CID | 88539062 |
| Molecular Formula | C9H11F3 |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | (3E)-2,3,5-trifluoro-4-propan-2-ylhexa-1,3,5-triene |
| SMILES | C=C(F)/C(F)=C(\C(=C)F)C(C)C |
| InChI | InChI=1S/C9H11F3/c1-5(2)8(6(3)10)9(12)7(4)11/h5H,3-4H2,1-2H3/b9-8+ |
| InChIKey | PKDUPVNRYHLQBM-CMDGGOBGSA-N |
| XLogP | 3.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|