C18H32O4 — CID 88539125
[(2S,3S,4S,5S,6E)-3,5-dimethoxy-2,4-dimethylnona-6,8-dienyl] 2,2-dimethylpropanoate (PubChem CID 88539125) has the molecular formula C18H32O4 and a molecular weight of 312.45 g/mol. Its IUPAC name is [(2S,3S,4S,5S,6E)-3,5-dimethoxy-2,4-dimethylnona-6,8-dienyl] 2,2-dimethylpropanoate.
| Compound Name | [(2S,3S,4S,5S,6E)-3,5-dimethoxy-2,4-dimethylnona-6,8-dienyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 88539125 |
| Molecular Formula | C18H32O4 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | [(2S,3S,4S,5S,6E)-3,5-dimethoxy-2,4-dimethylnona-6,8-dienyl] 2,2-dimethylpropanoate |
| SMILES | C=C/C=C/[C@H](OC)[C@H](C)[C@@H](OC)[C@@H](C)COC(=O)C(C)(C)C |
| InChI | InChI=1S/C18H32O4/c1-9-10-11-15(20-7)14(3)16(21-8)13(2)12-22-17(19)18(4,5)6/h9-11,13-16H,1,12H2,2-8H3/b11-10+/t13-,14-,15-,16-/m0/s1 |
| InChIKey | GFUYVYXBRLPQMO-FVPREIMJSA-N |
| XLogP | 3.62 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|