About S-(3-methylbut-3-enyl) 5-amino-2-ethyl-4-(2-methylphenyl)-3-oxopyrazole-1-carbothioate
S-(3-methylbut-3-enyl) 5-amino-2-ethyl-4-(2-methylphenyl)-3-oxopyrazole-1-carbothioate (PubChem CID 88539141) has the molecular formula C18H23N3O2S
and a molecular weight of 345.47 g/mol. Its IUPAC name is S-(3-methylbut-3-enyl) 5-amino-2-ethyl-4-(2-methylphenyl)-3-oxopyrazole-1-carbothioate.
Molecular Properties
| Compound Name | S-(3-methylbut-3-enyl) 5-amino-2-ethyl-4-(2-methylphenyl)-3-oxopyrazole-1-carbothioate |
| PubChem CID | 88539141 |
| Molecular Formula | C18H23N3O2S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | S-(3-methylbut-3-enyl) 5-amino-2-ethyl-4-(2-methylphenyl)-3-oxopyrazole-1-carbothioate |
| SMILES | C=C(C)CCSC(=O)n1c(N)c(-c2ccccc2C)c(=O)n1CC |
| InChI | InChI=1S/C18H23N3O2S/c1-5-20-17(22)15(14-9-7-6-8-13(14)4)16(19)21(20)18(23)24-11-10-12(2)3/h6-9H,2,5,10-11,19H2,1,3-4H3 |
| InChIKey | QZIAGQOBVXTJOU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 70.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(3-methylbut-3-enyl) 5-amino-2-ethyl-4-(2-methylphenyl)-3-oxopyrazole-1-carbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(3-methylbut-3-enyl) 5-amino-2-ethyl-4-(2-methylphenyl)-3-oxopyrazole-1-carbothioate?
The IUPAC name of S-(3-methylbut-3-enyl) 5-amino-2-ethyl-4-(2-methylphenyl)-3-oxopyrazole-1-carbothioate (CID 88539141) is S-(3-methylbut-3-enyl) 5-amino-2-ethyl-4-(2-methylphenyl)-3-oxopyrazole-1-carbothioate.
What is the SMILES notation for S-(3-methylbut-3-enyl) 5-amino-2-ethyl-4-(2-methylphenyl)-3-oxopyrazole-1-carbothioate?
The canonical SMILES for S-(3-methylbut-3-enyl) 5-amino-2-ethyl-4-(2-methylphenyl)-3-oxopyrazole-1-carbothioate is C=C(C)CCSC(=O)n1c(N)c(-c2ccccc2C)c(=O)n1CC.
What is the InChIKey of S-(3-methylbut-3-enyl) 5-amino-2-ethyl-4-(2-methylphenyl)-3-oxopyrazole-1-carbothioate?
The InChIKey is QZIAGQOBVXTJOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N3O2S/c1-5-20-17(22)15(14-9-7-6-8-13(14)4)16(19)21(20)18(23)24-11-10-12(2)3/h6-9H,2,5,10-11,19H2,1,3-4H3.
What are the key properties of S-(3-methylbut-3-enyl) 5-amino-2-ethyl-4-(2-methylphenyl)-3-oxopyrazole-1-carbothioate?
S-(3-methylbut-3-enyl) 5-amino-2-ethyl-4-(2-methylphenyl)-3-oxopyrazole-1-carbothioate has a molecular weight of 345.47 g/mol, XLogP of 3.89, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for S-(3-methylbut-3-enyl) 5-amino-2-ethyl-4-(2-methylphenyl)-3-oxopyrazole-1-carbothioate is sourced from PubChem (CID 88539141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).