C27H30Cl2F4N6O2 — CID 88539246
2-[2,6-dichloro-3-[(2,2-dimethylpropanoylamino)methyl]anilino]-6-(4-fluoropiperidin-1-yl)-N-(2,2,2-trifluoroethyl)-3H-benzimidazole-5-carboxamide (PubChem CID 88539246) has the molecular formula C27H30Cl2F4N6O2 and a molecular weight of 617.48 g/mol. Its IUPAC name is 2-[2,6-dichloro-3-[(2,2-dimethylpropanoylamino)methyl]anilino]-6-(4-fluoropiperidin-1-yl)-N-(2,2,2-trifluoroethyl)-3H-benzimidazole-5-carboxamide.
| Compound Name | 2-[2,6-dichloro-3-[(2,2-dimethylpropanoylamino)methyl]anilino]-6-(4-fluoropiperidin-1-yl)-N-(2,2,2-trifluoroethyl)-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 88539246 |
| Molecular Formula | C27H30Cl2F4N6O2 |
| Molecular Weight | 617.48 g/mol |
| Exact Mass | 616.17 |
| IUPAC Name | 2-[2,6-dichloro-3-[(2,2-dimethylpropanoylamino)methyl]anilino]-6-(4-fluoropiperidin-1-yl)-N-(2,2,2-trifluoroethyl)-3H-benzimidazole-5-carboxamide |
| SMILES | CC(C)(C)C(=O)NCc1ccc(Cl)c(Nc2nc3cc(N4CCC(F)CC4)c(C(=O)NCC(F)(F)F)cc3[nH]2)c1Cl |
| InChI | InChI=1S/C27H30Cl2F4N6O2/c1-26(2,3)24(41)34-12-14-4-5-17(28)22(21(14)29)38-25-36-18-10-16(23(40)35-13-27(31,32)33)20(11-19(18)37-25)39-8-6-15(30)7-9-39/h4-5,10-11,15H,6-9,12-13H2,1-3H3,(H,34,41)(H,35,40)(H2,36,37,38) |
| InChIKey | ZHPHADOBEQQPMO-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.48 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |