About N'-amino-N-buta-1,3-dien-2-yl-N-methylmethanimidamide
N'-amino-N-buta-1,3-dien-2-yl-N-methylmethanimidamide (PubChem CID 88539329) has the molecular formula C6H11N3
and a molecular weight of 125.17 g/mol. Its IUPAC name is N'-amino-N-buta-1,3-dien-2-yl-N-methylmethanimidamide.
Molecular Properties
| Compound Name | N'-amino-N-buta-1,3-dien-2-yl-N-methylmethanimidamide |
| PubChem CID | 88539329 |
| Molecular Formula | C6H11N3 |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.10 |
| IUPAC Name | N'-amino-N-buta-1,3-dien-2-yl-N-methylmethanimidamide |
| SMILES | C=CC(=C)N(C)/C=N\N |
| InChI | InChI=1S/C6H11N3/c1-4-6(2)9(3)5-8-7/h4-5H,1-2,7H2,3H3/b8-5- |
| InChIKey | KRGFATRRHRSGMY-YVMONPNESA-N |
| XLogP | 0.52 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N'-amino-N-buta-1,3-dien-2-yl-N-methylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-amino-N-buta-1,3-dien-2-yl-N-methylmethanimidamide?
The IUPAC name of N'-amino-N-buta-1,3-dien-2-yl-N-methylmethanimidamide (CID 88539329) is N'-amino-N-buta-1,3-dien-2-yl-N-methylmethanimidamide.
What is the SMILES notation for N'-amino-N-buta-1,3-dien-2-yl-N-methylmethanimidamide?
The canonical SMILES for N'-amino-N-buta-1,3-dien-2-yl-N-methylmethanimidamide is C=CC(=C)N(C)/C=N\N.
What is the InChIKey of N'-amino-N-buta-1,3-dien-2-yl-N-methylmethanimidamide?
The InChIKey is KRGFATRRHRSGMY-YVMONPNESA-N. The full InChI is InChI=1S/C6H11N3/c1-4-6(2)9(3)5-8-7/h4-5H,1-2,7H2,3H3/b8-5-.
What are the key properties of N'-amino-N-buta-1,3-dien-2-yl-N-methylmethanimidamide?
N'-amino-N-buta-1,3-dien-2-yl-N-methylmethanimidamide has a molecular weight of 125.17 g/mol, XLogP of 0.52, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-amino-N-buta-1,3-dien-2-yl-N-methylmethanimidamide is sourced from PubChem (CID 88539329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).