C22H22Cl2F2N4O4S2 — CID 88539604
1-(2,5-dichloropyrimidin-4-yl)-1,2-bis(2-fluoro-6-propylsulfonylphenyl)hydrazine (PubChem CID 88539604) has the molecular formula C22H22Cl2F2N4O4S2 and a molecular weight of 579.48 g/mol. Its IUPAC name is 1-(2,5-dichloropyrimidin-4-yl)-1,2-bis(2-fluoro-6-propylsulfonylphenyl)hydrazine.
| Compound Name | 1-(2,5-dichloropyrimidin-4-yl)-1,2-bis(2-fluoro-6-propylsulfonylphenyl)hydrazine |
|---|---|
| PubChem CID | 88539604 |
| Molecular Formula | C22H22Cl2F2N4O4S2 |
| Molecular Weight | 579.48 g/mol |
| Exact Mass | 578.04 |
| IUPAC Name | 1-(2,5-dichloropyrimidin-4-yl)-1,2-bis(2-fluoro-6-propylsulfonylphenyl)hydrazine |
| SMILES | CCCS(=O)(=O)c1cccc(F)c1NN(c1nc(Cl)ncc1Cl)c1c(F)cccc1S(=O)(=O)CCC |
| InChI | InChI=1S/C22H22Cl2F2N4O4S2/c1-3-11-35(31,32)17-9-5-7-15(25)19(17)29-30(21-14(23)13-27-22(24)28-21)20-16(26)8-6-10-18(20)36(33,34)12-4-2/h5-10,13,29H,3-4,11-12H2,1-2H3 |
| InChIKey | KIDJPSGVDPHVNK-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 109.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.48 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|