C26H35N5O3S2 — CID 88539959
2-(2-aminophenyl)-N'-[5-[1-(5-tert-butyl-1,3-oxazol-2-yl)ethylsulfanyl]-1,3-thiazol-2-yl]octanediamide (PubChem CID 88539959) has the molecular formula C26H35N5O3S2 and a molecular weight of 529.73 g/mol. Its IUPAC name is 2-(2-aminophenyl)-N'-[5-[1-(5-tert-butyl-1,3-oxazol-2-yl)ethylsulfanyl]-1,3-thiazol-2-yl]octanediamide.
| Compound Name | 2-(2-aminophenyl)-N'-[5-[1-(5-tert-butyl-1,3-oxazol-2-yl)ethylsulfanyl]-1,3-thiazol-2-yl]octanediamide |
|---|---|
| PubChem CID | 88539959 |
| Molecular Formula | C26H35N5O3S2 |
| Molecular Weight | 529.73 g/mol |
| Exact Mass | 529.22 |
| IUPAC Name | 2-(2-aminophenyl)-N'-[5-[1-(5-tert-butyl-1,3-oxazol-2-yl)ethylsulfanyl]-1,3-thiazol-2-yl]octanediamide |
| SMILES | CC(Sc1cnc(NC(=O)CCCCCC(C(N)=O)c2ccccc2N)s1)c1ncc(C(C)(C)C)o1 |
| InChI | InChI=1S/C26H35N5O3S2/c1-16(24-29-14-20(34-24)26(2,3)4)35-22-15-30-25(36-22)31-21(32)13-7-5-6-11-18(23(28)33)17-10-8-9-12-19(17)27/h8-10,12,14-16,18H,5-7,11,13,27H2,1-4H3,(H2,28,33)(H,30,31,32) |
| InChIKey | YFTYZFXKXSYBOU-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 137.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.73 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|