C26H32F3N7O5S3 — CID 88540108
4-[[(1R)-3-morpholin-4-yl-1-phenylpropyl]-(sulfanylmethyl)amino]-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)-3-(trifluoromethylsulfonyl)benzenesulfonamide (PubChem CID 88540108) has the molecular formula C26H32F3N7O5S3 and a molecular weight of 675.78 g/mol. Its IUPAC name is 4-[[(1R)-3-morpholin-4-yl-1-phenylpropyl]-(sulfanylmethyl)amino]-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)-3-(trifluoromethylsulfonyl)benzenesulfonamide.
| Compound Name | 4-[[(1R)-3-morpholin-4-yl-1-phenylpropyl]-(sulfanylmethyl)amino]-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)-3-(trifluoromethylsulfonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 88540108 |
| Molecular Formula | C26H32F3N7O5S3 |
| Molecular Weight | 675.78 g/mol |
| Exact Mass | 675.16 |
| IUPAC Name | 4-[[(1R)-3-morpholin-4-yl-1-phenylpropyl]-(sulfanylmethyl)amino]-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)-3-(trifluoromethylsulfonyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1nnc2n1CCNC2)c1ccc(N(CS)[C@H](CCN2CCOCC2)c2ccccc2)c(S(=O)(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C26H32F3N7O5S3/c27-26(28,29)43(37,38)23-16-20(44(39,40)33-25-32-31-24-17-30-9-11-35(24)25)6-7-22(23)36(18-42)21(19-4-2-1-3-5-19)8-10-34-12-14-41-15-13-34/h1-7,16,21,30,42H,8-15,17-18H2,(H,32,33)/t21-/m1/s1 |
| InChIKey | NARPQPKQRPYCEY-OAQYLSRUSA-N |
| XLogP | 2.63 |
| TPSA | 138.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.78 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|