About 2,2-dimethylpropanoic acid;ethyl benzoate;zinc
2,2-dimethylpropanoic acid;ethyl benzoate;zinc (PubChem CID 88541031) has the molecular formula C14H19O4Zn-
and a molecular weight of 316.69 g/mol. Its IUPAC name is 2,2-dimethylpropanoic acid;ethyl benzoate;zinc.
Molecular Properties
| Compound Name | 2,2-dimethylpropanoic acid;ethyl benzoate;zinc |
| PubChem CID | 88541031 |
| Molecular Formula | C14H19O4Zn- |
| Molecular Weight | 316.69 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 2,2-dimethylpropanoic acid;ethyl benzoate;zinc |
| SMILES | CC(C)(C)C(=O)O.CCOC(=O)c1cc[c-]cc1.[Zn] |
| InChI | InChI=1S/C9H9O2.C5H10O2.Zn/c1-2-11-9(10)8-6-4-3-5-7-8;1-5(2,3)4(6)7;/h4-7H,2H2,1H3;1-3H3,(H,6,7);/q-1;; |
| InChIKey | QTNXFZNHMBTBFM-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.69 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethylpropanoic acid;ethyl benzoate;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylpropanoic acid;ethyl benzoate;zinc?
The IUPAC name of 2,2-dimethylpropanoic acid;ethyl benzoate;zinc (CID 88541031) is 2,2-dimethylpropanoic acid;ethyl benzoate;zinc.
What is the SMILES notation for 2,2-dimethylpropanoic acid;ethyl benzoate;zinc?
The canonical SMILES for 2,2-dimethylpropanoic acid;ethyl benzoate;zinc is CC(C)(C)C(=O)O.CCOC(=O)c1cc[c-]cc1.[Zn].
What is the InChIKey of 2,2-dimethylpropanoic acid;ethyl benzoate;zinc?
The InChIKey is QTNXFZNHMBTBFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9O2.C5H10O2.Zn/c1-2-11-9(10)8-6-4-3-5-7-8;1-5(2,3)4(6)7;/h4-7H,2H2,1H3;1-3H3,(H,6,7);/q-1;;.
What are the key properties of 2,2-dimethylpropanoic acid;ethyl benzoate;zinc?
2,2-dimethylpropanoic acid;ethyl benzoate;zinc has a molecular weight of 316.69 g/mol, XLogP of 2.78, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylpropanoic acid;ethyl benzoate;zinc is sourced from PubChem (CID 88541031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).