About 2-chloro-5,6-difluoroquinoxaline
2-chloro-5,6-difluoroquinoxaline (PubChem CID 88541050) has the molecular formula C8H3ClF2N2
and a molecular weight of 200.58 g/mol. Its IUPAC name is 2-chloro-5,6-difluoroquinoxaline.
Molecular Properties
| Compound Name | 2-chloro-5,6-difluoroquinoxaline |
| PubChem CID | 88541050 |
| Molecular Formula | C8H3ClF2N2 |
| Molecular Weight | 200.58 g/mol |
| Exact Mass | 200.00 |
| IUPAC Name | 2-chloro-5,6-difluoroquinoxaline |
| SMILES | Fc1ccc2nc(Cl)cnc2c1F |
| InChI | InChI=1S/C8H3ClF2N2/c9-6-3-12-8-5(13-6)2-1-4(10)7(8)11/h1-3H |
| InChIKey | NHANSNTVEPGKJW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.58 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-chloro-5,6-difluoroquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5,6-difluoroquinoxaline?
The IUPAC name of 2-chloro-5,6-difluoroquinoxaline (CID 88541050) is 2-chloro-5,6-difluoroquinoxaline.
What is the SMILES notation for 2-chloro-5,6-difluoroquinoxaline?
The canonical SMILES for 2-chloro-5,6-difluoroquinoxaline is Fc1ccc2nc(Cl)cnc2c1F.
What is the InChIKey of 2-chloro-5,6-difluoroquinoxaline?
The InChIKey is NHANSNTVEPGKJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3ClF2N2/c9-6-3-12-8-5(13-6)2-1-4(10)7(8)11/h1-3H.
What are the key properties of 2-chloro-5,6-difluoroquinoxaline?
2-chloro-5,6-difluoroquinoxaline has a molecular weight of 200.58 g/mol, XLogP of 2.56, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5,6-difluoroquinoxaline is sourced from PubChem (CID 88541050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).