C8H12F9N3O2S — CID 88541320
N,N-bis(2-aminoethyl)-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonamide (PubChem CID 88541320) has the molecular formula C8H12F9N3O2S and a molecular weight of 385.25 g/mol. Its IUPAC name is N,N-bis(2-aminoethyl)-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonamide.
| Compound Name | N,N-bis(2-aminoethyl)-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonamide |
|---|---|
| PubChem CID | 88541320 |
| Molecular Formula | C8H12F9N3O2S |
| Molecular Weight | 385.25 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | N,N-bis(2-aminoethyl)-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonamide |
| SMILES | NCCN(CCN)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H12F9N3O2S/c9-5(10,7(13,14)15)6(11,12)8(16,17)23(21,22)20(3-1-18)4-2-19/h1-4,18-19H2 |
| InChIKey | JKBAJYPJVWKACZ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.25 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|