C30H32F3N5O4 — CID 88541474
5-[4-[2-[3-(2,2-dimethylpropanoylamino)-4-methylphenyl]imidazo[1,2-b]pyridazin-6-yl]-3-(trifluoromethyl)phenoxy]-N-hydroxypentanamide (PubChem CID 88541474) has the molecular formula C30H32F3N5O4 and a molecular weight of 583.61 g/mol. Its IUPAC name is 5-[4-[2-[3-(2,2-dimethylpropanoylamino)-4-methylphenyl]imidazo[1,2-b]pyridazin-6-yl]-3-(trifluoromethyl)phenoxy]-N-hydroxypentanamide.
| Compound Name | 5-[4-[2-[3-(2,2-dimethylpropanoylamino)-4-methylphenyl]imidazo[1,2-b]pyridazin-6-yl]-3-(trifluoromethyl)phenoxy]-N-hydroxypentanamide |
|---|---|
| PubChem CID | 88541474 |
| Molecular Formula | C30H32F3N5O4 |
| Molecular Weight | 583.61 g/mol |
| Exact Mass | 583.24 |
| IUPAC Name | 5-[4-[2-[3-(2,2-dimethylpropanoylamino)-4-methylphenyl]imidazo[1,2-b]pyridazin-6-yl]-3-(trifluoromethyl)phenoxy]-N-hydroxypentanamide |
| SMILES | Cc1ccc(-c2cn3nc(-c4ccc(OCCCCC(=O)NO)cc4C(F)(F)F)ccc3n2)cc1NC(=O)C(C)(C)C |
| InChI | InChI=1S/C30H32F3N5O4/c1-18-8-9-19(15-24(18)35-28(40)29(2,3)4)25-17-38-26(34-25)13-12-23(36-38)21-11-10-20(16-22(21)30(31,32)33)42-14-6-5-7-27(39)37-41/h8-13,15-17,41H,5-7,14H2,1-4H3,(H,35,40)(H,37,39) |
| InChIKey | NWGGOSIANORLTK-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.61 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|