About N-(3,3-diethoxypropyl)-3,3-diethoxypropan-1-amine
N-(3,3-diethoxypropyl)-3,3-diethoxypropan-1-amine (PubChem CID 88541962) has the molecular formula C14H31NO4
and a molecular weight of 277.40 g/mol. Its IUPAC name is N-(3,3-diethoxypropyl)-3,3-diethoxypropan-1-amine.
Molecular Properties
| Compound Name | N-(3,3-diethoxypropyl)-3,3-diethoxypropan-1-amine |
| PubChem CID | 88541962 |
| Molecular Formula | C14H31NO4 |
| Molecular Weight | 277.40 g/mol |
| Exact Mass | 277.23 |
| IUPAC Name | N-(3,3-diethoxypropyl)-3,3-diethoxypropan-1-amine |
| SMILES | CCOC(CCNCCC(OCC)OCC)OCC |
| InChI | InChI=1S/C14H31NO4/c1-5-16-13(17-6-2)9-11-15-12-10-14(18-7-3)19-8-4/h13-15H,5-12H2,1-4H3 |
| InChIKey | KHROONGOSYUOFD-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-(3,3-diethoxypropyl)-3,3-diethoxypropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,3-diethoxypropyl)-3,3-diethoxypropan-1-amine?
The IUPAC name of N-(3,3-diethoxypropyl)-3,3-diethoxypropan-1-amine (CID 88541962) is N-(3,3-diethoxypropyl)-3,3-diethoxypropan-1-amine.
What is the SMILES notation for N-(3,3-diethoxypropyl)-3,3-diethoxypropan-1-amine?
The canonical SMILES for N-(3,3-diethoxypropyl)-3,3-diethoxypropan-1-amine is CCOC(CCNCCC(OCC)OCC)OCC.
What is the InChIKey of N-(3,3-diethoxypropyl)-3,3-diethoxypropan-1-amine?
The InChIKey is KHROONGOSYUOFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H31NO4/c1-5-16-13(17-6-2)9-11-15-12-10-14(18-7-3)19-8-4/h13-15H,5-12H2,1-4H3.
What are the key properties of N-(3,3-diethoxypropyl)-3,3-diethoxypropan-1-amine?
N-(3,3-diethoxypropyl)-3,3-diethoxypropan-1-amine has a molecular weight of 277.40 g/mol, XLogP of 2.15, 14 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,3-diethoxypropyl)-3,3-diethoxypropan-1-amine is sourced from PubChem (CID 88541962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).