C63H41N9 — CID 88542106
2-[3,5-bis(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]-4,6-bis(4-phenylphenyl)-1,3,5-triazine (PubChem CID 88542106) has the molecular formula C63H41N9 and a molecular weight of 924.08 g/mol. Its IUPAC name is 2-[3,5-bis(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]-4,6-bis(4-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-[3,5-bis(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]-4,6-bis(4-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 88542106 |
| Molecular Formula | C63H41N9 |
| Molecular Weight | 924.08 g/mol |
| Exact Mass | 923.35 |
| IUPAC Name | 2-[3,5-bis(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]-4,6-bis(4-phenylphenyl)-1,3,5-triazine |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccc(-c5ccccc5)cc4)nc(-c4cc(-c5cc(-c6ccccn6)nc(-c6ccccn6)c5)cc(-c5cc(-c6ccccn6)nc(-c6ccccn6)c5)c4)n3)cc2)cc1 |
| InChI | InChI=1S/C63H41N9/c1-3-15-42(16-4-1)44-23-27-46(28-24-44)61-70-62(47-29-25-45(26-30-47)43-17-5-2-6-18-43)72-63(71-61)52-36-48(50-38-57(53-19-7-11-31-64-53)68-58(39-50)54-20-8-12-32-65-54)35-49(37-52)51-40-59(55-21-9-13-33-66-55)69-60(41-51)56-22-10-14-34-67-56/h1-41H |
| InChIKey | HCOJZGQHBLJABQ-UHFFFAOYSA-N |
| XLogP | 14.58 |
| TPSA | 116.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 924.08 |
| LogP ≤ 5 | 14.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |