About 1-cyclopropyloxy-2,4-difluorobenzene;1,3-thiazol-2-ylcarbamic acid
1-cyclopropyloxy-2,4-difluorobenzene;1,3-thiazol-2-ylcarbamic acid (PubChem CID 88542127) has the molecular formula C13H12F2N2O3S
and a molecular weight of 314.31 g/mol. Its IUPAC name is 1-cyclopropyloxy-2,4-difluorobenzene;1,3-thiazol-2-ylcarbamic acid.
Molecular Properties
| Compound Name | 1-cyclopropyloxy-2,4-difluorobenzene;1,3-thiazol-2-ylcarbamic acid |
| PubChem CID | 88542127 |
| Molecular Formula | C13H12F2N2O3S |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 1-cyclopropyloxy-2,4-difluorobenzene;1,3-thiazol-2-ylcarbamic acid |
| SMILES | Fc1ccc(OC2CC2)c(F)c1.O=C(O)Nc1nccs1 |
| InChI | InChI=1S/C9H8F2O.C4H4N2O2S/c10-6-1-4-9(8(11)5-6)12-7-2-3-7;7-4(8)6-3-5-1-2-9-3/h1,4-5,7H,2-3H2;1-2H,(H,5,6)(H,7,8) |
| InChIKey | WVLQNMAOBFOXCU-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-cyclopropyloxy-2,4-difluorobenzene;1,3-thiazol-2-ylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyloxy-2,4-difluorobenzene;1,3-thiazol-2-ylcarbamic acid?
The IUPAC name of 1-cyclopropyloxy-2,4-difluorobenzene;1,3-thiazol-2-ylcarbamic acid (CID 88542127) is 1-cyclopropyloxy-2,4-difluorobenzene;1,3-thiazol-2-ylcarbamic acid.
What is the SMILES notation for 1-cyclopropyloxy-2,4-difluorobenzene;1,3-thiazol-2-ylcarbamic acid?
The canonical SMILES for 1-cyclopropyloxy-2,4-difluorobenzene;1,3-thiazol-2-ylcarbamic acid is Fc1ccc(OC2CC2)c(F)c1.O=C(O)Nc1nccs1.
What is the InChIKey of 1-cyclopropyloxy-2,4-difluorobenzene;1,3-thiazol-2-ylcarbamic acid?
The InChIKey is WVLQNMAOBFOXCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F2O.C4H4N2O2S/c10-6-1-4-9(8(11)5-6)12-7-2-3-7;7-4(8)6-3-5-1-2-9-3/h1,4-5,7H,2-3H2;1-2H,(H,5,6)(H,7,8).
What are the key properties of 1-cyclopropyloxy-2,4-difluorobenzene;1,3-thiazol-2-ylcarbamic acid?
1-cyclopropyloxy-2,4-difluorobenzene;1,3-thiazol-2-ylcarbamic acid has a molecular weight of 314.31 g/mol, XLogP of 3.74, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyloxy-2,4-difluorobenzene;1,3-thiazol-2-ylcarbamic acid is sourced from PubChem (CID 88542127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).