C10H14Br4N2O6 — CID 88542144
1,1,3,3-tetrabromo-2,2-dimethoxy-4,4-dimethyl-5,5-dinitrocyclohexane (PubChem CID 88542144) has the molecular formula C10H14Br4N2O6 and a molecular weight of 577.85 g/mol. Its IUPAC name is 1,1,3,3-tetrabromo-2,2-dimethoxy-4,4-dimethyl-5,5-dinitrocyclohexane.
| Compound Name | 1,1,3,3-tetrabromo-2,2-dimethoxy-4,4-dimethyl-5,5-dinitrocyclohexane |
|---|---|
| PubChem CID | 88542144 |
| Molecular Formula | C10H14Br4N2O6 |
| Molecular Weight | 577.85 g/mol |
| Exact Mass | 573.76 |
| IUPAC Name | 1,1,3,3-tetrabromo-2,2-dimethoxy-4,4-dimethyl-5,5-dinitrocyclohexane |
| SMILES | COC1(OC)C(Br)(Br)CC([N+](=O)[O-])([N+](=O)[O-])C(C)(C)C1(Br)Br |
| InChI | InChI=1S/C10H14Br4N2O6/c1-6(2)8(15(17)18,16(19)20)5-7(11,12)10(21-3,22-4)9(6,13)14/h5H2,1-4H3 |
| InChIKey | CQOFJEMCDVFCPI-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 104.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.85 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|