About 2-acetamidooctan-2-yl acetate
2-acetamidooctan-2-yl acetate (PubChem CID 88542217) has the molecular formula C12H23NO3
and a molecular weight of 229.32 g/mol. Its IUPAC name is 2-acetamidooctan-2-yl acetate.
Molecular Properties
| Compound Name | 2-acetamidooctan-2-yl acetate |
| PubChem CID | 88542217 |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | 2-acetamidooctan-2-yl acetate |
| SMILES | CCCCCCC(C)(NC(C)=O)OC(C)=O |
| InChI | InChI=1S/C12H23NO3/c1-5-6-7-8-9-12(4,13-10(2)14)16-11(3)15/h5-9H2,1-4H3,(H,13,14) |
| InChIKey | RPZLVQVATMOVDC-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-acetamidooctan-2-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetamidooctan-2-yl acetate?
The IUPAC name of 2-acetamidooctan-2-yl acetate (CID 88542217) is 2-acetamidooctan-2-yl acetate.
What is the SMILES notation for 2-acetamidooctan-2-yl acetate?
The canonical SMILES for 2-acetamidooctan-2-yl acetate is CCCCCCC(C)(NC(C)=O)OC(C)=O.
What is the InChIKey of 2-acetamidooctan-2-yl acetate?
The InChIKey is RPZLVQVATMOVDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO3/c1-5-6-7-8-9-12(4,13-10(2)14)16-11(3)15/h5-9H2,1-4H3,(H,13,14).
What are the key properties of 2-acetamidooctan-2-yl acetate?
2-acetamidooctan-2-yl acetate has a molecular weight of 229.32 g/mol, XLogP of 2.37, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetamidooctan-2-yl acetate is sourced from PubChem (CID 88542217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).