About 4-isocyano-2,5-dimethylthiophene-3-carbonitrile
4-isocyano-2,5-dimethylthiophene-3-carbonitrile (PubChem CID 88542495) has the molecular formula C8H6N2S
and a molecular weight of 162.22 g/mol. Its IUPAC name is 4-isocyano-2,5-dimethylthiophene-3-carbonitrile.
Molecular Properties
| Compound Name | 4-isocyano-2,5-dimethylthiophene-3-carbonitrile |
| PubChem CID | 88542495 |
| Molecular Formula | C8H6N2S |
| Molecular Weight | 162.22 g/mol |
| Exact Mass | 162.03 |
| IUPAC Name | 4-isocyano-2,5-dimethylthiophene-3-carbonitrile |
| SMILES | [C-]#[N+]c1c(C)sc(C)c1C#N |
| InChI | InChI=1S/C8H6N2S/c1-5-7(4-9)8(10-3)6(2)11-5/h1-2H3 |
| InChIKey | WRVPBVIVLGZSSC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.22 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4-isocyano-2,5-dimethylthiophene-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-isocyano-2,5-dimethylthiophene-3-carbonitrile?
The IUPAC name of 4-isocyano-2,5-dimethylthiophene-3-carbonitrile (CID 88542495) is 4-isocyano-2,5-dimethylthiophene-3-carbonitrile.
What is the SMILES notation for 4-isocyano-2,5-dimethylthiophene-3-carbonitrile?
The canonical SMILES for 4-isocyano-2,5-dimethylthiophene-3-carbonitrile is [C-]#[N+]c1c(C)sc(C)c1C#N.
What is the InChIKey of 4-isocyano-2,5-dimethylthiophene-3-carbonitrile?
The InChIKey is WRVPBVIVLGZSSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2S/c1-5-7(4-9)8(10-3)6(2)11-5/h1-2H3.
What are the key properties of 4-isocyano-2,5-dimethylthiophene-3-carbonitrile?
4-isocyano-2,5-dimethylthiophene-3-carbonitrile has a molecular weight of 162.22 g/mol, XLogP of 2.79, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-isocyano-2,5-dimethylthiophene-3-carbonitrile is sourced from PubChem (CID 88542495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).