C18H18F6O11 — CID 88542500
[3,4-diacetyloxy-5,6-bis[(2,2,2-trifluoroacetyl)oxy]oxan-2-yl]methyl 2-methylprop-2-enoate (PubChem CID 88542500) has the molecular formula C18H18F6O11 and a molecular weight of 524.32 g/mol. Its IUPAC name is [3,4-diacetyloxy-5,6-bis[(2,2,2-trifluoroacetyl)oxy]oxan-2-yl]methyl 2-methylprop-2-enoate.
| Compound Name | [3,4-diacetyloxy-5,6-bis[(2,2,2-trifluoroacetyl)oxy]oxan-2-yl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 88542500 |
| Molecular Formula | C18H18F6O11 |
| Molecular Weight | 524.32 g/mol |
| Exact Mass | 524.08 |
| IUPAC Name | [3,4-diacetyloxy-5,6-bis[(2,2,2-trifluoroacetyl)oxy]oxan-2-yl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC1OC(OC(=O)C(F)(F)F)C(OC(=O)C(F)(F)F)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C18H18F6O11/c1-6(2)13(27)30-5-9-10(31-7(3)25)11(32-8(4)26)12(34-15(28)17(19,20)21)14(33-9)35-16(29)18(22,23)24/h9-12,14H,1,5H2,2-4H3 |
| InChIKey | ORUIPRDHJOYZJP-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.32 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|