C16H20F6O6S2 — CID 88542739
3-[3-(4-butan-2-ylphenyl)propoxysulfonyl]-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid (PubChem CID 88542739) has the molecular formula C16H20F6O6S2 and a molecular weight of 486.45 g/mol. Its IUPAC name is 3-[3-(4-butan-2-ylphenyl)propoxysulfonyl]-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid.
| Compound Name | 3-[3-(4-butan-2-ylphenyl)propoxysulfonyl]-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 88542739 |
| Molecular Formula | C16H20F6O6S2 |
| Molecular Weight | 486.45 g/mol |
| Exact Mass | 486.06 |
| IUPAC Name | 3-[3-(4-butan-2-ylphenyl)propoxysulfonyl]-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid |
| SMILES | CCC(C)c1ccc(CCCOS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C16H20F6O6S2/c1-3-11(2)13-8-6-12(7-9-13)5-4-10-28-30(26,27)16(21,22)14(17,18)15(19,20)29(23,24)25/h6-9,11H,3-5,10H2,1-2H3,(H,23,24,25) |
| InChIKey | FVIYGDBRNHPHQN-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.45 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|