C18H18F4O4S — CID 88542753
2,3,5,6-tetrafluoro-4-[[4-(2-methylbutan-2-yl)phenyl]methoxy]benzenesulfonic acid (PubChem CID 88542753) has the molecular formula C18H18F4O4S and a molecular weight of 406.40 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[[4-(2-methylbutan-2-yl)phenyl]methoxy]benzenesulfonic acid.
| Compound Name | 2,3,5,6-tetrafluoro-4-[[4-(2-methylbutan-2-yl)phenyl]methoxy]benzenesulfonic acid |
|---|---|
| PubChem CID | 88542753 |
| Molecular Formula | C18H18F4O4S |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[[4-(2-methylbutan-2-yl)phenyl]methoxy]benzenesulfonic acid |
| SMILES | CCC(C)(C)c1ccc(COc2c(F)c(F)c(S(=O)(=O)O)c(F)c2F)cc1 |
| InChI | InChI=1S/C18H18F4O4S/c1-4-18(2,3)11-7-5-10(6-8-11)9-26-16-12(19)14(21)17(27(23,24)25)15(22)13(16)20/h5-8H,4,9H2,1-3H3,(H,23,24,25) |
| InChIKey | ZMAAINQJWUIQRC-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|