C18H12F12O11 — CID 88542820
[3,4,5,6-tetrakis[(2,2,2-trifluoroacetyl)oxy]oxan-2-yl]methyl 2-methylprop-2-enoate (PubChem CID 88542820) has the molecular formula C18H12F12O11 and a molecular weight of 632.26 g/mol. Its IUPAC name is [3,4,5,6-tetrakis[(2,2,2-trifluoroacetyl)oxy]oxan-2-yl]methyl 2-methylprop-2-enoate.
| Compound Name | [3,4,5,6-tetrakis[(2,2,2-trifluoroacetyl)oxy]oxan-2-yl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 88542820 |
| Molecular Formula | C18H12F12O11 |
| Molecular Weight | 632.26 g/mol |
| Exact Mass | 632.02 |
| IUPAC Name | [3,4,5,6-tetrakis[(2,2,2-trifluoroacetyl)oxy]oxan-2-yl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC1OC(OC(=O)C(F)(F)F)C(OC(=O)C(F)(F)F)C(OC(=O)C(F)(F)F)C1OC(=O)C(F)(F)F |
| InChI | InChI=1S/C18H12F12O11/c1-4(2)9(31)36-3-5-6(38-11(32)15(19,20)21)7(39-12(33)16(22,23)24)8(40-13(34)17(25,26)27)10(37-5)41-14(35)18(28,29)30/h5-8,10H,1,3H2,2H3 |
| InChIKey | AUNJZWHXVOFWJN-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.26 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|