C14H23N — CID 88542970
(3Z,5Z,7Z)-2,4-dimethyl-5-propylnona-1,3,5,7-tetraen-3-amine (PubChem CID 88542970) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is (3Z,5Z,7Z)-2,4-dimethyl-5-propylnona-1,3,5,7-tetraen-3-amine.
| Compound Name | (3Z,5Z,7Z)-2,4-dimethyl-5-propylnona-1,3,5,7-tetraen-3-amine |
|---|---|
| PubChem CID | 88542970 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | (3Z,5Z,7Z)-2,4-dimethyl-5-propylnona-1,3,5,7-tetraen-3-amine |
| SMILES | C=C(C)/C(N)=C(C)/C(=C\C=C/C)CCC |
| InChI | InChI=1S/C14H23N/c1-6-8-10-13(9-7-2)12(5)14(15)11(3)4/h6,8,10H,3,7,9,15H2,1-2,4-5H3/b8-6-,13-10-,14-12- |
| InChIKey | SXOBFGLQRYQTPA-MXEREDMMSA-N |
| XLogP | 4.10 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|