C26H23N7O2 — CID 88543081
triazolo[4,5-b]pyridin-3-yl 1-[4-[2-(2,5-dimethylpyrrol-1-yl)pyrimidin-5-yl]phenyl]cyclobutane-1-carboxylate (PubChem CID 88543081) has the molecular formula C26H23N7O2 and a molecular weight of 465.52 g/mol. Its IUPAC name is triazolo[4,5-b]pyridin-3-yl 1-[4-[2-(2,5-dimethylpyrrol-1-yl)pyrimidin-5-yl]phenyl]cyclobutane-1-carboxylate.
| Compound Name | triazolo[4,5-b]pyridin-3-yl 1-[4-[2-(2,5-dimethylpyrrol-1-yl)pyrimidin-5-yl]phenyl]cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 88543081 |
| Molecular Formula | C26H23N7O2 |
| Molecular Weight | 465.52 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | triazolo[4,5-b]pyridin-3-yl 1-[4-[2-(2,5-dimethylpyrrol-1-yl)pyrimidin-5-yl]phenyl]cyclobutane-1-carboxylate |
| SMILES | Cc1ccc(C)n1-c1ncc(-c2ccc(C3(C(=O)On4nnc5cccnc54)CCC3)cc2)cn1 |
| InChI | InChI=1S/C26H23N7O2/c1-17-6-7-18(2)32(17)25-28-15-20(16-29-25)19-8-10-21(11-9-19)26(12-4-13-26)24(34)35-33-23-22(30-31-33)5-3-14-27-23/h3,5-11,14-16H,4,12-13H2,1-2H3 |
| InChIKey | STXWOLKRRSENCY-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 100.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.52 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ester_of_HOBT', 'substructure': 'N/A'} |
|---|